![5-Chloromethyl-1H-pyrrolo[2,3-b]pyridine hydrochloride (CAS: 900514-05-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678180.png "5-Chloromethyl-1H-pyrrolo[2,3-b]pyridine hydrochloride chemical structure")
5-Chloromethyl-1H-pyrrolo[2,3-b]pyridine hydrochloride
Catalog No: FT-0678180
CAS No: 900514-05-8
- Chemical Name: 5-Chloromethyl-1H-pyrrolo[2,3-b]pyridine hydrochloride
- Molecular Formula: C8H8Cl2N2
- Molecular Weight: 203.07
- InChI Key: CDUSDQWROLIRTH-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7ClN2.ClH/c9-4-6-3-7-1-2-10-8(7)11-5-6;/h1-3,5H,4H2,(H,10,11);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 203.06900 |
| Density: | N/A |
| CAS: | 900514-05-8 |
| Bolling_Point: | N/A |
| Product_Name: | 5-(chloromethyl)-1H-pyrrolo[2,3-b]pyridine,hydrochloride |
| Melting_Point: | >230ºC |
| Flash_Point: | N/A |
| MF: | C8H8Cl2N2 |
| LogP: | 3.10370 |
|---|---|
| Melting_Point: | >230ºC |
| FW: | 203.06900 |
| PSA: | 28.68000 |
| MF: | C8H8Cl2N2 |
| Exact_Mass: | 202.00600 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
